C32H32N6O7S — CID 175871938
N-[4-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-2-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 175871938) has the molecular formula C32H32N6O7S and a molecular weight of 644.71 g/mol. Its IUPAC name is N-[4-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-2-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[4-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-2-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 175871938 |
| Molecular Formula | C32H32N6O7S |
| Molecular Weight | 644.71 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | N-[4-[[4-[3-(dimethylamino)propoxy]phenyl]methylamino]-2-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | CN(C)CCCOc1ccc(CNc2ccc(S(=O)(=O)NC(=O)c3ccccc3Oc3cnc4[nH]ccc4c3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C32H32N6O7S/c1-37(2)16-5-17-44-25-11-8-22(9-12-25)20-34-24-10-13-30(28(19-24)38(40)41)46(42,43)36-32(39)27-6-3-4-7-29(27)45-26-18-23-14-15-33-31(23)35-21-26/h3-4,6-15,18-19,21,34H,5,16-17,20H2,1-2H3,(H,33,35)(H,36,39) |
| InChIKey | POUYNGSUNPCVLM-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 168.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|