C28H28ClN5O3 — CID 24811244
2-chloro-5-[[(E)-3-[4-[3-(dimethylamino)propoxy]phenyl]prop-2-enoyl]amino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide (PubChem CID 24811244) has the molecular formula C28H28ClN5O3 and a molecular weight of 518.02 g/mol. Its IUPAC name is 2-chloro-5-[[(E)-3-[4-[3-(dimethylamino)propoxy]phenyl]prop-2-enoyl]amino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide.
| Compound Name | 2-chloro-5-[[(E)-3-[4-[3-(dimethylamino)propoxy]phenyl]prop-2-enoyl]amino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 24811244 |
| Molecular Formula | C28H28ClN5O3 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | 2-chloro-5-[[(E)-3-[4-[3-(dimethylamino)propoxy]phenyl]prop-2-enoyl]amino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
| SMILES | CN(C)CCCOc1ccc(/C=C/C(=O)Nc2ccc(Cl)c(C(=O)Nc3cnc4[nH]ccc4c3)c2)cc1 |
| InChI | InChI=1S/C28H28ClN5O3/c1-34(2)14-3-15-37-23-8-4-19(5-9-23)6-11-26(35)32-21-7-10-25(29)24(17-21)28(36)33-22-16-20-12-13-30-27(20)31-18-22/h4-13,16-18H,3,14-15H2,1-2H3,(H,30,31)(H,32,35)(H,33,36)/b11-6+ |
| InChIKey | MLUDUVXMWLRHTH-IZZDOVSWSA-N |
| XLogP | 5.45 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|