C24H18ClFN4O3 — CID 67007164
2-chloro-4-fluoro-5-[3-(2-methoxyphenyl)prop-2-enoylamino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide (PubChem CID 67007164) has the molecular formula C24H18ClFN4O3 and a molecular weight of 464.88 g/mol. Its IUPAC name is 2-chloro-4-fluoro-5-[3-(2-methoxyphenyl)prop-2-enoylamino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide.
| Compound Name | 2-chloro-4-fluoro-5-[3-(2-methoxyphenyl)prop-2-enoylamino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 67007164 |
| Molecular Formula | C24H18ClFN4O3 |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 2-chloro-4-fluoro-5-[3-(2-methoxyphenyl)prop-2-enoylamino]-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
| SMILES | COc1ccccc1C=CC(=O)Nc1cc(C(=O)Nc2cnc3[nH]ccc3c2)c(Cl)cc1F |
| InChI | InChI=1S/C24H18ClFN4O3/c1-33-21-5-3-2-4-14(21)6-7-22(31)30-20-11-17(18(25)12-19(20)26)24(32)29-16-10-15-8-9-27-23(15)28-13-16/h2-13H,1H3,(H,27,28)(H,29,32)(H,30,31) |
| InChIKey | CNZISOHPUCUEOV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|