C16H13Cl2N3O3 — CID 25122284
2,6-dichloro-3,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide (PubChem CID 25122284) has the molecular formula C16H13Cl2N3O3 and a molecular weight of 366.20 g/mol. Its IUPAC name is 2,6-dichloro-3,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide.
| Compound Name | 2,6-dichloro-3,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
|---|---|
| PubChem CID | 25122284 |
| Molecular Formula | C16H13Cl2N3O3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2,6-dichloro-3,5-dimethoxy-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzamide |
| SMILES | COc1cc(OC)c(Cl)c(C(=O)Nc2cnc3[nH]ccc3c2)c1Cl |
| InChI | InChI=1S/C16H13Cl2N3O3/c1-23-10-6-11(24-2)14(18)12(13(10)17)16(22)21-9-5-8-3-4-19-15(8)20-7-9/h3-7H,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | RYADBGCNLMHPDA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |