C16H13N3O3 — CID 67007623
2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-5-ylcarbamoyl)benzoic acid (PubChem CID 67007623) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-5-ylcarbamoyl)benzoic acid.
| Compound Name | 2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-5-ylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 67007623 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-methyl-5-(1H-pyrrolo[2,3-b]pyridin-5-ylcarbamoyl)benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2cnc3[nH]ccc3c2)cc1C(=O)O |
| InChI | InChI=1S/C16H13N3O3/c1-9-2-3-11(7-13(9)16(21)22)15(20)19-12-6-10-4-5-17-14(10)18-8-12/h2-8H,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | HSXUZLNEIQZCTE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |