C18H24F3NO3 — CID 60584177
methyl 4-methyl-2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]pentanoate (PubChem CID 60584177) has the molecular formula C18H24F3NO3 and a molecular weight of 359.39 g/mol. Its IUPAC name is methyl 4-methyl-2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]pentanoate.
| Compound Name | methyl 4-methyl-2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]pentanoate |
|---|---|
| PubChem CID | 60584177 |
| Molecular Formula | C18H24F3NO3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | methyl 4-methyl-2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)CC(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3NO3/c1-11(2)9-15(17(24)25-4)22-16(23)10-12(3)13-5-7-14(8-6-13)18(19,20)21/h5-8,11-12,15H,9-10H2,1-4H3,(H,22,23) |
| InChIKey | UPOAMNALOBQTNS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |