C18H27ClF3N3O — CID 119392989
N-(3-piperazin-1-ylpropyl)-3-[4-(trifluoromethyl)phenyl]butanamide;hydrochloride (PubChem CID 119392989) has the molecular formula C18H27ClF3N3O and a molecular weight of 393.88 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-3-[4-(trifluoromethyl)phenyl]butanamide;hydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)-3-[4-(trifluoromethyl)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119392989 |
| Molecular Formula | C18H27ClF3N3O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-3-[4-(trifluoromethyl)phenyl]butanamide;hydrochloride |
| SMILES | CC(CC(=O)NCCCN1CCNCC1)c1ccc(C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C18H26F3N3O.ClH/c1-14(15-3-5-16(6-4-15)18(19,20)21)13-17(25)23-7-2-10-24-11-8-22-9-12-24;/h3-6,14,22H,2,7-13H2,1H3,(H,23,25);1H |
| InChIKey | GQNPGOWAJJPBFQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|