C23H23N5O3S — CID 56520040
4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide (PubChem CID 56520040) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is 4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide.
| Compound Name | 4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide |
|---|---|
| PubChem CID | 56520040 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 4-oxo-4-(3-oxo-2,4-dihydroquinoxalin-1-yl)-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide |
| SMILES | O=C(CCC(=O)N1CC(=O)Nc2ccccc21)NCCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C23H23N5O3S/c29-20(7-8-23(31)28-14-21(30)26-17-4-1-2-5-19(17)28)25-11-3-6-22-27-18(15-32-22)16-9-12-24-13-10-16/h1-2,4-5,9-10,12-13,15H,3,6-8,11,14H2,(H,25,29)(H,26,30) |
| InChIKey | CIABGMMXOYPJNP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|