C23H19N5O3S — CID 108748555
4-(dimethylamino)-3-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide (PubChem CID 108748555) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is 4-(dimethylamino)-3-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide.
| Compound Name | 4-(dimethylamino)-3-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 108748555 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 4-(dimethylamino)-3-nitro-N-[3-(2-pyridin-3-yl-1,3-thiazol-4-yl)phenyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2cccc(-c3csc(-c4cccnc4)n3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H19N5O3S/c1-27(2)20-9-8-16(12-21(20)28(30)31)22(29)25-18-7-3-5-15(11-18)19-14-32-23(26-19)17-6-4-10-24-13-17/h3-14H,1-2H3,(H,25,29) |
| InChIKey | ZPAFMOKXNJXTDX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|