C21H28O2 — CID 162161241
4,6-diphenylnonane-1,1-diol (PubChem CID 162161241) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 4,6-diphenylnonane-1,1-diol.
| Compound Name | 4,6-diphenylnonane-1,1-diol |
|---|---|
| PubChem CID | 162161241 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 4,6-diphenylnonane-1,1-diol |
| SMILES | CCCC(CC(CCC(O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O2/c1-2-9-19(17-10-5-3-6-11-17)16-20(14-15-21(22)23)18-12-7-4-8-13-18/h3-8,10-13,19-23H,2,9,14-16H2,1H3 |
| InChIKey | ZMMYBFINQAFIPB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|