C16H26O2 — CID 175195889
6,8-dimethoxyoctan-4-ylbenzene (PubChem CID 175195889) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 6,8-dimethoxyoctan-4-ylbenzene.
| Compound Name | 6,8-dimethoxyoctan-4-ylbenzene |
|---|---|
| PubChem CID | 175195889 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 6,8-dimethoxyoctan-4-ylbenzene |
| SMILES | CCCC(CC(CCOC)OC)c1ccccc1 |
| InChI | InChI=1S/C16H26O2/c1-4-8-15(14-9-6-5-7-10-14)13-16(18-3)11-12-17-2/h5-7,9-10,15-16H,4,8,11-13H2,1-3H3 |
| InChIKey | OQBZGWWTPYHTDO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |