C15H25NO2 — CID 113368973
N-(2,3-dimethoxypropyl)-1-phenylbutan-1-amine (PubChem CID 113368973) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-(2,3-dimethoxypropyl)-1-phenylbutan-1-amine.
| Compound Name | N-(2,3-dimethoxypropyl)-1-phenylbutan-1-amine |
|---|---|
| PubChem CID | 113368973 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-(2,3-dimethoxypropyl)-1-phenylbutan-1-amine |
| SMILES | CCCC(NCC(COC)OC)c1ccccc1 |
| InChI | InChI=1S/C15H25NO2/c1-4-8-15(13-9-6-5-7-10-13)16-11-14(18-3)12-17-2/h5-7,9-10,14-16H,4,8,11-12H2,1-3H3 |
| InChIKey | GPTLZHNTEUOAEI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |