C17H29NO — CID 104628715
4-methoxy-2,2-dimethyl-N-(1-phenylbutyl)butan-1-amine (PubChem CID 104628715) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 4-methoxy-2,2-dimethyl-N-(1-phenylbutyl)butan-1-amine.
| Compound Name | 4-methoxy-2,2-dimethyl-N-(1-phenylbutyl)butan-1-amine |
|---|---|
| PubChem CID | 104628715 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-methoxy-2,2-dimethyl-N-(1-phenylbutyl)butan-1-amine |
| SMILES | CCCC(NCC(C)(C)CCOC)c1ccccc1 |
| InChI | InChI=1S/C17H29NO/c1-5-9-16(15-10-7-6-8-11-15)18-14-17(2,3)12-13-19-4/h6-8,10-11,16,18H,5,9,12-14H2,1-4H3 |
| InChIKey | KDRPSGPWISWNMJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |