C22H33NO4 — CID 173492109
(4Z,7Z,10Z,16Z,19Z)-14-hydroxy-13-nitrodocosa-4,7,10,16,19-pentaenal (PubChem CID 173492109) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is (4Z,7Z,10Z,16Z,19Z)-14-hydroxy-13-nitrodocosa-4,7,10,16,19-pentaenal.
| Compound Name | (4Z,7Z,10Z,16Z,19Z)-14-hydroxy-13-nitrodocosa-4,7,10,16,19-pentaenal |
|---|---|
| PubChem CID | 173492109 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | (4Z,7Z,10Z,16Z,19Z)-14-hydroxy-13-nitrodocosa-4,7,10,16,19-pentaenal |
| SMILES | CC/C=C\C/C=C\CC(O)C(C/C=C\C/C=C\C/C=C\CCC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C22H33NO4/c1-2-3-4-5-13-16-19-22(25)21(23(26)27)18-15-12-10-8-6-7-9-11-14-17-20-24/h3-4,6,8-9,11-13,15-16,20-22,25H,2,5,7,10,14,17-19H2,1H3/b4-3-,8-6-,11-9-,15-12-,16-13- |
| InChIKey | SJVOGTCCNMOPJK-HFGAGAPOSA-N |
| XLogP | 5.11 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|