C22H31NO4 — CID 87379609
(4E,7E,10E,13E,16E,19E)-2-nitrodocosa-4,7,10,13,16,19-hexaenoic acid (PubChem CID 87379609) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (4E,7E,10E,13E,16E,19E)-2-nitrodocosa-4,7,10,13,16,19-hexaenoic acid.
| Compound Name | (4E,7E,10E,13E,16E,19E)-2-nitrodocosa-4,7,10,13,16,19-hexaenoic acid |
|---|---|
| PubChem CID | 87379609 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (4E,7E,10E,13E,16E,19E)-2-nitrodocosa-4,7,10,13,16,19-hexaenoic acid |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CC(C(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C22H31NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22(24)25)23(26)27/h3-4,6-7,9-10,12-13,15-16,18-19,21H,2,5,8,11,14,17,20H2,1H3,(H,24,25)/b4-3+,7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | ILNDNDGIZMDWDA-SFGLVEFQSA-N |
| XLogP | 5.80 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|