C23H32O2S — CID 87581725
2-methanethioyldocosa-4,7,10,13,16,19-hexaenoic acid (PubChem CID 87581725) has the molecular formula C23H32O2S and a molecular weight of 372.57 g/mol. Its IUPAC name is 2-methanethioyldocosa-4,7,10,13,16,19-hexaenoic acid.
| Compound Name | 2-methanethioyldocosa-4,7,10,13,16,19-hexaenoic acid |
|---|---|
| PubChem CID | 87581725 |
| Molecular Formula | C23H32O2S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-methanethioyldocosa-4,7,10,13,16,19-hexaenoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCC(C=S)C(=O)O |
| InChI | InChI=1S/C23H32O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(21-26)23(24)25/h3-4,6-7,9-10,12-13,15-16,18-19,21-22H,2,5,8,11,14,17,20H2,1H3,(H,24,25) |
| InChIKey | IOBIUAVHOBVPOU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|