C21H30O2S — CID 123778500
2-methanethioylicosa-5,8,11,14,17-pentaenoic acid (PubChem CID 123778500) has the molecular formula C21H30O2S and a molecular weight of 346.54 g/mol. Its IUPAC name is 2-methanethioylicosa-5,8,11,14,17-pentaenoic acid.
| Compound Name | 2-methanethioylicosa-5,8,11,14,17-pentaenoic acid |
|---|---|
| PubChem CID | 123778500 |
| Molecular Formula | C21H30O2S |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-methanethioylicosa-5,8,11,14,17-pentaenoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCC(C=S)C(=O)O |
| InChI | InChI=1S/C21H30O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(19-24)21(22)23/h3-4,6-7,9-10,12-13,15-16,19-20H,2,5,8,11,14,17-18H2,1H3,(H,22,23) |
| InChIKey | COWZBEKBXOMJKR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|