(5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid

C22H34O2 — CID 175828480

IUPAC(5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid
SMILESCCC=CCC=CCC=CCC=CC/C=C\CCC(CC)C(=O)O
InChIInChI=1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(4-2)22(23)24/h5-6,8-9,11-12,14-15,17-18,21H,3-4,7,10,13,16,19-20H2,1-2H3,(H,23,24)/b6-5?,9-8?,12-11?,15-14?,18-17-
InChIKeyLNPJFFYITCWQDB-ZCFPAKLASA-N
MW330.51 g/mol
LogP6.63
Rot. Bonds14

About (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid

(5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid (PubChem CID 175828480) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid.

Molecular Properties

Compound Name(5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid
PubChem CID175828480
Molecular FormulaC22H34O2
Molecular Weight330.51 g/mol
Exact Mass330.26
IUPAC Name(5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid
SMILESCCC=CCC=CCC=CCC=CC/C=C\CCC(CC)C(=O)O
InChIInChI=1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(4-2)22(23)24/h5-6,8-9,11-12,14-15,17-18,21H,3-4,7,10,13,16,19-20H2,1-2H3,(H,23,24)/b6-5?,9-8?,12-11?,15-14?,18-17-
InChIKeyLNPJFFYITCWQDB-ZCFPAKLASA-N
XLogP6.63
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds14
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500330.51
LogP ≤ 56.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid?
The IUPAC name of (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid (CID 175828480) is (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid.
What is the SMILES notation for (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid?
The canonical SMILES for (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid is CCC=CCC=CCC=CCC=CC/C=C\CCC(CC)C(=O)O.
What is the InChIKey of (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid?
The InChIKey is LNPJFFYITCWQDB-ZCFPAKLASA-N. The full InChI is InChI=1S/C22H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(4-2)22(23)24/h5-6,8-9,11-12,14-15,17-18,21H,3-4,7,10,13,16,19-20H2,1-2H3,(H,23,24)/b6-5?,9-8?,12-11?,15-14?,18-17-.
What are the key properties of (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid?
(5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid has a molecular weight of 330.51 g/mol, XLogP of 6.63, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-2-ethylicosa-5,8,11,14,17-pentaenoic acid is sourced from PubChem (CID 175828480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).