C22H33NO2 — CID 22344833
(3E,6E,9E,12E,15E,18E)-22-nitrodocosa-3,6,9,12,15,18-hexaene (PubChem CID 22344833) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (3E,6E,9E,12E,15E,18E)-22-nitrodocosa-3,6,9,12,15,18-hexaene.
| Compound Name | (3E,6E,9E,12E,15E,18E)-22-nitrodocosa-3,6,9,12,15,18-hexaene |
|---|---|
| PubChem CID | 22344833 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (3E,6E,9E,12E,15E,18E)-22-nitrodocosa-3,6,9,12,15,18-hexaene |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC[N+](=O)[O-] |
| InChI | InChI=1S/C22H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-22H2,1H3/b4-3+,7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | QTWKLIRZXRSJDT-SFGLVEFQSA-N |
| XLogP | 6.74 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|