About 1-nitropentane;uranium
1-nitropentane;uranium (PubChem CID 163660530) has the molecular formula C5H10NO2U-
and a molecular weight of 354.17 g/mol. Its IUPAC name is 1-nitropentane;uranium.
Molecular Properties
| Compound Name | 1-nitropentane;uranium |
| PubChem CID | 163660530 |
| Molecular Formula | C5H10NO2U- |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-nitropentane;uranium |
| SMILES | [CH2-]CCCC[N+](=O)[O-].[U] |
| InChI | InChI=1S/C5H10NO2.U/c1-2-3-4-5-6(7)8;/h1-5H2;/q-1; |
| InChIKey | RYKKMJSCFZRUGM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitropentane;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitropentane;uranium?
The IUPAC name of 1-nitropentane;uranium (CID 163660530) is 1-nitropentane;uranium.
What is the SMILES notation for 1-nitropentane;uranium?
The canonical SMILES for 1-nitropentane;uranium is [CH2-]CCCC[N+](=O)[O-].[U].
What is the InChIKey of 1-nitropentane;uranium?
The InChIKey is RYKKMJSCFZRUGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10NO2.U/c1-2-3-4-5-6(7)8;/h1-5H2;/q-1;.
What are the key properties of 1-nitropentane;uranium?
1-nitropentane;uranium has a molecular weight of 354.17 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitropentane;uranium is sourced from PubChem (CID 163660530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).