About 7-nitroheptan-2-yl acetate
7-nitroheptan-2-yl acetate (PubChem CID 10899711) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 7-nitroheptan-2-yl acetate.
Molecular Properties
| Compound Name | 7-nitroheptan-2-yl acetate |
| PubChem CID | 10899711 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 7-nitroheptan-2-yl acetate |
| SMILES | CC(=O)OC(C)CCCCC[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO4/c1-8(14-9(2)11)6-4-3-5-7-10(12)13/h8H,3-7H2,1-2H3 |
| InChIKey | YRSPQWIEZXNLLA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-nitroheptan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitroheptan-2-yl acetate?
The IUPAC name of 7-nitroheptan-2-yl acetate (CID 10899711) is 7-nitroheptan-2-yl acetate.
What is the SMILES notation for 7-nitroheptan-2-yl acetate?
The canonical SMILES for 7-nitroheptan-2-yl acetate is CC(=O)OC(C)CCCCC[N+](=O)[O-].
What is the InChIKey of 7-nitroheptan-2-yl acetate?
The InChIKey is YRSPQWIEZXNLLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO4/c1-8(14-9(2)11)6-4-3-5-7-10(12)13/h8H,3-7H2,1-2H3.
What are the key properties of 7-nitroheptan-2-yl acetate?
7-nitroheptan-2-yl acetate has a molecular weight of 203.24 g/mol, XLogP of 1.78, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitroheptan-2-yl acetate is sourced from PubChem (CID 10899711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).