About 1,5-dinitropentan-3-one
1,5-dinitropentan-3-one (PubChem CID 150801945) has the molecular formula C5H8N2O5
and a molecular weight of 176.13 g/mol. Its IUPAC name is 1,5-dinitropentan-3-one.
Molecular Properties
| Compound Name | 1,5-dinitropentan-3-one |
| PubChem CID | 150801945 |
| Molecular Formula | C5H8N2O5 |
| Molecular Weight | 176.13 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 1,5-dinitropentan-3-one |
| SMILES | O=C(CC[N+](=O)[O-])CC[N+](=O)[O-] |
| InChI | InChI=1S/C5H8N2O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2 |
| InChIKey | KGAXNYXMWAYHFZ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.13 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dinitropentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dinitropentan-3-one?
The IUPAC name of 1,5-dinitropentan-3-one (CID 150801945) is 1,5-dinitropentan-3-one.
What is the SMILES notation for 1,5-dinitropentan-3-one?
The canonical SMILES for 1,5-dinitropentan-3-one is O=C(CC[N+](=O)[O-])CC[N+](=O)[O-].
What is the InChIKey of 1,5-dinitropentan-3-one?
The InChIKey is KGAXNYXMWAYHFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O5/c8-5(1-3-6(9)10)2-4-7(11)12/h1-4H2.
What are the key properties of 1,5-dinitropentan-3-one?
1,5-dinitropentan-3-one has a molecular weight of 176.13 g/mol, XLogP of -0.11, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dinitropentan-3-one is sourced from PubChem (CID 150801945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).