About O-prop-2-enyl 3-nitropropanethioate
O-prop-2-enyl 3-nitropropanethioate (PubChem CID 89145385) has the molecular formula C6H9NO3S
and a molecular weight of 175.21 g/mol. Its IUPAC name is O-prop-2-enyl 3-nitropropanethioate.
Molecular Properties
| Compound Name | O-prop-2-enyl 3-nitropropanethioate |
| PubChem CID | 89145385 |
| Molecular Formula | C6H9NO3S |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.03 |
| IUPAC Name | O-prop-2-enyl 3-nitropropanethioate |
| SMILES | C=CCOC(=S)CC[N+](=O)[O-] |
| InChI | InChI=1S/C6H9NO3S/c1-2-5-10-6(11)3-4-7(8)9/h2H,1,3-5H2 |
| InChIKey | JIFLUNSEDLRUPG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-prop-2-enyl 3-nitropropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-prop-2-enyl 3-nitropropanethioate?
The IUPAC name of O-prop-2-enyl 3-nitropropanethioate (CID 89145385) is O-prop-2-enyl 3-nitropropanethioate.
What is the SMILES notation for O-prop-2-enyl 3-nitropropanethioate?
The canonical SMILES for O-prop-2-enyl 3-nitropropanethioate is C=CCOC(=S)CC[N+](=O)[O-].
What is the InChIKey of O-prop-2-enyl 3-nitropropanethioate?
The InChIKey is JIFLUNSEDLRUPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3S/c1-2-5-10-6(11)3-4-7(8)9/h2H,1,3-5H2.
What are the key properties of O-prop-2-enyl 3-nitropropanethioate?
O-prop-2-enyl 3-nitropropanethioate has a molecular weight of 175.21 g/mol, XLogP of 1.18, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-prop-2-enyl 3-nitropropanethioate is sourced from PubChem (CID 89145385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).