About 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate
1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate (PubChem CID 10857293) has the molecular formula C9H13NO6
and a molecular weight of 231.20 g/mol. Its IUPAC name is 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate |
| PubChem CID | 10857293 |
| Molecular Formula | C9H13NO6 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate |
| SMILES | C=CCOC(=O)CCC(C(=O)OC)[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO6/c1-3-6-16-8(11)5-4-7(10(13)14)9(12)15-2/h3,7H,1,4-6H2,2H3 |
| InChIKey | OFSCQFSETOENAK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate?
The IUPAC name of 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate (CID 10857293) is 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate.
What is the SMILES notation for 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate?
The canonical SMILES for 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate is C=CCOC(=O)CCC(C(=O)OC)[N+](=O)[O-].
What is the InChIKey of 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate?
The InChIKey is OFSCQFSETOENAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO6/c1-3-6-16-8(11)5-4-7(10(13)14)9(12)15-2/h3,7H,1,4-6H2,2H3.
What are the key properties of 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate?
1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate has a molecular weight of 231.20 g/mol, XLogP of 0.31, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 5-O-prop-2-enyl 2-nitropentanedioate is sourced from PubChem (CID 10857293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).