About sodium 2-nitroethanolate
sodium 2-nitroethanolate (PubChem CID 15264148) has the molecular formula C2H4NNaO3
and a molecular weight of 113.05 g/mol. Its IUPAC name is sodium 2-nitroethanolate.
Molecular Properties
| Compound Name | sodium 2-nitroethanolate |
| PubChem CID | 15264148 |
| Molecular Formula | C2H4NNaO3 |
| Molecular Weight | 113.05 g/mol |
| Exact Mass | 113.01 |
| IUPAC Name | sodium 2-nitroethanolate |
| SMILES | O=[N+]([O-])CC[O-].[Na+] |
| InChI | InChI=1S/C2H4NO3.Na/c4-2-1-3(5)6;/h1-2H2;/q-1;+1 |
| InChIKey | PRGKVPLZPHINSZ-UHFFFAOYSA-N |
| XLogP | -4.37 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.05 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-nitroethanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-nitroethanolate?
The IUPAC name of sodium 2-nitroethanolate (CID 15264148) is sodium 2-nitroethanolate.
What is the SMILES notation for sodium 2-nitroethanolate?
The canonical SMILES for sodium 2-nitroethanolate is O=[N+]([O-])CC[O-].[Na+].
What is the InChIKey of sodium 2-nitroethanolate?
The InChIKey is PRGKVPLZPHINSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4NO3.Na/c4-2-1-3(5)6;/h1-2H2;/q-1;+1.
What are the key properties of sodium 2-nitroethanolate?
sodium 2-nitroethanolate has a molecular weight of 113.05 g/mol, XLogP of -4.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-nitroethanolate is sourced from PubChem (CID 15264148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).