About 2-nitroethanesulfonate
2-nitroethanesulfonate (PubChem CID 18945789) has the molecular formula C2H4NO5S-
and a molecular weight of 154.12 g/mol. Its IUPAC name is 2-nitroethanesulfonate.
Molecular Properties
| Compound Name | 2-nitroethanesulfonate |
| PubChem CID | 18945789 |
| Molecular Formula | C2H4NO5S- |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 153.98 |
| IUPAC Name | 2-nitroethanesulfonate |
| SMILES | O=[N+]([O-])CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C2H5NO5S/c4-3(5)1-2-9(6,7)8/h1-2H2,(H,6,7,8)/p-1 |
| InChIKey | XUQAFGRPWSFCHX-UHFFFAOYSA-M |
| XLogP | -1.19 |
| TPSA | 100.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethanesulfonate?
The IUPAC name of 2-nitroethanesulfonate (CID 18945789) is 2-nitroethanesulfonate.
What is the SMILES notation for 2-nitroethanesulfonate?
The canonical SMILES for 2-nitroethanesulfonate is O=[N+]([O-])CCS(=O)(=O)[O-].
What is the InChIKey of 2-nitroethanesulfonate?
The InChIKey is XUQAFGRPWSFCHX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO5S/c4-3(5)1-2-9(6,7)8/h1-2H2,(H,6,7,8)/p-1.
What are the key properties of 2-nitroethanesulfonate?
2-nitroethanesulfonate has a molecular weight of 154.12 g/mol, XLogP of -1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethanesulfonate is sourced from PubChem (CID 18945789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).