C3H4Cl3NO2 — CID 22061819
1,1,1-trichloro-3-nitropropane (PubChem CID 22061819) has the molecular formula C3H4Cl3NO2 and a molecular weight of 192.43 g/mol. Its IUPAC name is 1,1,1-trichloro-3-nitropropane.
| Compound Name | 1,1,1-trichloro-3-nitropropane |
|---|---|
| PubChem CID | 22061819 |
| Molecular Formula | C3H4Cl3NO2 |
| Molecular Weight | 192.43 g/mol |
| Exact Mass | 190.93 |
| IUPAC Name | 1,1,1-trichloro-3-nitropropane |
| SMILES | O=[N+]([O-])CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H4Cl3NO2/c4-3(5,6)1-2-7(8)9/h1-2H2 |
| InChIKey | NNCAOGVANFMLII-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|