C9H8F3NO2 — CID 163265622
1-(1,1-difluoro-3-nitropropyl)-4-fluorobenzene (PubChem CID 163265622) has the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. Its IUPAC name is 1-(1,1-difluoro-3-nitropropyl)-4-fluorobenzene.
| Compound Name | 1-(1,1-difluoro-3-nitropropyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 163265622 |
| Molecular Formula | C9H8F3NO2 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-(1,1-difluoro-3-nitropropyl)-4-fluorobenzene |
| SMILES | O=[N+]([O-])CCC(F)(F)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H8F3NO2/c10-8-3-1-7(2-4-8)9(11,12)5-6-13(14)15/h1-4H,5-6H2 |
| InChIKey | DASQCMOTBIFZDM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|