About 1-bromo-4-nitrobutane-1,1-diol
1-bromo-4-nitrobutane-1,1-diol (PubChem CID 87266539) has the molecular formula C4H8BrNO4
and a molecular weight of 214.01 g/mol. Its IUPAC name is 1-bromo-4-nitrobutane-1,1-diol.
Molecular Properties
| Compound Name | 1-bromo-4-nitrobutane-1,1-diol |
| PubChem CID | 87266539 |
| Molecular Formula | C4H8BrNO4 |
| Molecular Weight | 214.01 g/mol |
| Exact Mass | 212.96 |
| IUPAC Name | 1-bromo-4-nitrobutane-1,1-diol |
| SMILES | O=[N+]([O-])CCCC(O)(O)Br |
| InChI | InChI=1S/C4H8BrNO4/c5-4(7,8)2-1-3-6(9)10/h7-8H,1-3H2 |
| InChIKey | PGMLCWDMQURUFH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.01 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-nitrobutane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-nitrobutane-1,1-diol?
The IUPAC name of 1-bromo-4-nitrobutane-1,1-diol (CID 87266539) is 1-bromo-4-nitrobutane-1,1-diol.
What is the SMILES notation for 1-bromo-4-nitrobutane-1,1-diol?
The canonical SMILES for 1-bromo-4-nitrobutane-1,1-diol is O=[N+]([O-])CCCC(O)(O)Br.
What is the InChIKey of 1-bromo-4-nitrobutane-1,1-diol?
The InChIKey is PGMLCWDMQURUFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8BrNO4/c5-4(7,8)2-1-3-6(9)10/h7-8H,1-3H2.
What are the key properties of 1-bromo-4-nitrobutane-1,1-diol?
1-bromo-4-nitrobutane-1,1-diol has a molecular weight of 214.01 g/mol, XLogP of 0.08, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-nitrobutane-1,1-diol is sourced from PubChem (CID 87266539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).