About 2-nitroethanesulfinyl chloride
2-nitroethanesulfinyl chloride (PubChem CID 165461475) has the molecular formula C2H4ClNO3S
and a molecular weight of 157.58 g/mol. Its IUPAC name is 2-nitroethanesulfinyl chloride.
Molecular Properties
| Compound Name | 2-nitroethanesulfinyl chloride |
| PubChem CID | 165461475 |
| Molecular Formula | C2H4ClNO3S |
| Molecular Weight | 157.58 g/mol |
| Exact Mass | 156.96 |
| IUPAC Name | 2-nitroethanesulfinyl chloride |
| SMILES | O=[N+]([O-])CCS(=O)Cl |
| InChI | InChI=1S/C2H4ClNO3S/c3-8(7)2-1-4(5)6/h1-2H2 |
| InChIKey | MUIXNKDQLMFYEO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.58 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethanesulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethanesulfinyl chloride?
The IUPAC name of 2-nitroethanesulfinyl chloride (CID 165461475) is 2-nitroethanesulfinyl chloride.
What is the SMILES notation for 2-nitroethanesulfinyl chloride?
The canonical SMILES for 2-nitroethanesulfinyl chloride is O=[N+]([O-])CCS(=O)Cl.
What is the InChIKey of 2-nitroethanesulfinyl chloride?
The InChIKey is MUIXNKDQLMFYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClNO3S/c3-8(7)2-1-4(5)6/h1-2H2.
What are the key properties of 2-nitroethanesulfinyl chloride?
2-nitroethanesulfinyl chloride has a molecular weight of 157.58 g/mol, XLogP of 0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethanesulfinyl chloride is sourced from PubChem (CID 165461475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).