About 3-nitropropyl hydrogen sulfite
3-nitropropyl hydrogen sulfite (PubChem CID 174785156) has the molecular formula C3H7NO5S
and a molecular weight of 169.16 g/mol. Its IUPAC name is 3-nitropropyl hydrogen sulfite.
Molecular Properties
| Compound Name | 3-nitropropyl hydrogen sulfite |
| PubChem CID | 174785156 |
| Molecular Formula | C3H7NO5S |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 3-nitropropyl hydrogen sulfite |
| SMILES | O=[N+]([O-])CCCOS(=O)O |
| InChI | InChI=1S/C3H7NO5S/c5-4(6)2-1-3-9-10(7)8/h1-3H2,(H,7,8) |
| InChIKey | XILUJCQFCDHBMF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropropyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropropyl hydrogen sulfite?
The IUPAC name of 3-nitropropyl hydrogen sulfite (CID 174785156) is 3-nitropropyl hydrogen sulfite.
What is the SMILES notation for 3-nitropropyl hydrogen sulfite?
The canonical SMILES for 3-nitropropyl hydrogen sulfite is O=[N+]([O-])CCCOS(=O)O.
What is the InChIKey of 3-nitropropyl hydrogen sulfite?
The InChIKey is XILUJCQFCDHBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO5S/c5-4(6)2-1-3-9-10(7)8/h1-3H2,(H,7,8).
What are the key properties of 3-nitropropyl hydrogen sulfite?
3-nitropropyl hydrogen sulfite has a molecular weight of 169.16 g/mol, XLogP of -0.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropropyl hydrogen sulfite is sourced from PubChem (CID 174785156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).