About 3-nitropropane-1,1-diamine
3-nitropropane-1,1-diamine (PubChem CID 91146188) has the molecular formula C3H9N3O2
and a molecular weight of 119.12 g/mol. Its IUPAC name is 3-nitropropane-1,1-diamine.
Molecular Properties
| Compound Name | 3-nitropropane-1,1-diamine |
| PubChem CID | 91146188 |
| Molecular Formula | C3H9N3O2 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 3-nitropropane-1,1-diamine |
| SMILES | NC(N)CC[N+](=O)[O-] |
| InChI | InChI=1S/C3H9N3O2/c4-3(5)1-2-6(7)8/h3H,1-2,4-5H2 |
| InChIKey | DYAZMZWBTXRQII-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropropane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropropane-1,1-diamine?
The IUPAC name of 3-nitropropane-1,1-diamine (CID 91146188) is 3-nitropropane-1,1-diamine.
What is the SMILES notation for 3-nitropropane-1,1-diamine?
The canonical SMILES for 3-nitropropane-1,1-diamine is NC(N)CC[N+](=O)[O-].
What is the InChIKey of 3-nitropropane-1,1-diamine?
The InChIKey is DYAZMZWBTXRQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N3O2/c4-3(5)1-2-6(7)8/h3H,1-2,4-5H2.
What are the key properties of 3-nitropropane-1,1-diamine?
3-nitropropane-1,1-diamine has a molecular weight of 119.12 g/mol, XLogP of -1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropropane-1,1-diamine is sourced from PubChem (CID 91146188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).