About N-benzylpropan-1-amine;nitromethane
N-benzylpropan-1-amine;nitromethane (PubChem CID 90801656) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is N-benzylpropan-1-amine;nitromethane.
Molecular Properties
| Compound Name | N-benzylpropan-1-amine;nitromethane |
| PubChem CID | 90801656 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-benzylpropan-1-amine;nitromethane |
| SMILES | CCCNCc1ccccc1.C[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N.CH3NO2/c1-2-8-11-9-10-6-4-3-5-7-10;1-2(3)4/h3-7,11H,2,8-9H2,1H3;1H3 |
| InChIKey | REYRZUOZHUFBNK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzylpropan-1-amine;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylpropan-1-amine;nitromethane?
The IUPAC name of N-benzylpropan-1-amine;nitromethane (CID 90801656) is N-benzylpropan-1-amine;nitromethane.
What is the SMILES notation for N-benzylpropan-1-amine;nitromethane?
The canonical SMILES for N-benzylpropan-1-amine;nitromethane is CCCNCc1ccccc1.C[N+](=O)[O-].
What is the InChIKey of N-benzylpropan-1-amine;nitromethane?
The InChIKey is REYRZUOZHUFBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.CH3NO2/c1-2-8-11-9-10-6-4-3-5-7-10;1-2(3)4/h3-7,11H,2,8-9H2,1H3;1H3.
What are the key properties of N-benzylpropan-1-amine;nitromethane?
N-benzylpropan-1-amine;nitromethane has a molecular weight of 210.28 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylpropan-1-amine;nitromethane is sourced from PubChem (CID 90801656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).