C11H18KN3O2 — CID 173189588
potassium;N'-benzyl-N-(2-nitroethyl)ethane-1,2-diamine;hydride (PubChem CID 173189588) has the molecular formula C11H18KN3O2 and a molecular weight of 263.38 g/mol. Its IUPAC name is potassium;N'-benzyl-N-(2-nitroethyl)ethane-1,2-diamine;hydride.
| Compound Name | potassium;N'-benzyl-N-(2-nitroethyl)ethane-1,2-diamine;hydride |
|---|---|
| PubChem CID | 173189588 |
| Molecular Formula | C11H18KN3O2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | potassium;N'-benzyl-N-(2-nitroethyl)ethane-1,2-diamine;hydride |
| SMILES | O=[N+]([O-])CCNCCNCc1ccccc1.[H-].[K+] |
| InChI | InChI=1S/C11H17N3O2.K.H/c15-14(16)9-8-12-6-7-13-10-11-4-2-1-3-5-11;;/h1-5,12-13H,6-10H2;;/q;+1;-1 |
| InChIKey | GLSSUZWRJKBHGF-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|