About N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene
N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene (PubChem CID 123491626) has the molecular formula C26H32N2O3
and a molecular weight of 420.55 g/mol. Its IUPAC name is N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene.
Molecular Properties
| Compound Name | N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene |
| PubChem CID | 123491626 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene |
| SMILES | C=O.O=[N+]([O-])CCc1ccccc1.c1ccc(CCCCNCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N.C8H9NO2.CH2O/c1-3-9-16(10-4-1)11-7-8-14-18-15-17-12-5-2-6-13-17;10-9(11)7-6-8-4-2-1-3-5-8;1-2/h1-6,9-10,12-13,18H,7-8,11,14-15H2;1-5H,6-7H2;1H2 |
| InChIKey | AHDXHKRFTIIQKO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene?
The IUPAC name of N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene (CID 123491626) is N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene.
What is the SMILES notation for N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene?
The canonical SMILES for N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene is C=O.O=[N+]([O-])CCc1ccccc1.c1ccc(CCCCNCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene?
The InChIKey is AHDXHKRFTIIQKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N.C8H9NO2.CH2O/c1-3-9-16(10-4-1)11-7-8-14-18-15-17-12-5-2-6-13-17;10-9(11)7-6-8-4-2-1-3-5-8;1-2/h1-6,9-10,12-13,18H,7-8,11,14-15H2;1-5H,6-7H2;1H2.
What are the key properties of N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene?
N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene has a molecular weight of 420.55 g/mol, XLogP of 5.12, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-phenylbutan-1-amine;formaldehyde;2-nitroethylbenzene is sourced from PubChem (CID 123491626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).