About ethynylbenzene;nitromethane
ethynylbenzene;nitromethane (PubChem CID 161408391) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is ethynylbenzene;nitromethane.
Molecular Properties
| Compound Name | ethynylbenzene;nitromethane |
| PubChem CID | 161408391 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | ethynylbenzene;nitromethane |
| SMILES | C#Cc1ccccc1.C[N+](=O)[O-] |
| InChI | InChI=1S/C8H6.CH3NO2/c1-2-8-6-4-3-5-7-8;1-2(3)4/h1,3-7H;1H3 |
| InChIKey | VVDOCOBJIHDSPR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethynylbenzene;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethynylbenzene;nitromethane?
The IUPAC name of ethynylbenzene;nitromethane (CID 161408391) is ethynylbenzene;nitromethane.
What is the SMILES notation for ethynylbenzene;nitromethane?
The canonical SMILES for ethynylbenzene;nitromethane is C#Cc1ccccc1.C[N+](=O)[O-].
What is the InChIKey of ethynylbenzene;nitromethane?
The InChIKey is VVDOCOBJIHDSPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6.CH3NO2/c1-2-8-6-4-3-5-7-8;1-2(3)4/h1,3-7H;1H3.
What are the key properties of ethynylbenzene;nitromethane?
ethynylbenzene;nitromethane has a molecular weight of 163.18 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethynylbenzene;nitromethane is sourced from PubChem (CID 161408391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).