About benzonitrile;2,2-dinitroacetonitrile
benzonitrile;2,2-dinitroacetonitrile (PubChem CID 174896159) has the molecular formula C9H6N4O4
and a molecular weight of 234.17 g/mol. Its IUPAC name is benzonitrile;2,2-dinitroacetonitrile.
Molecular Properties
| Compound Name | benzonitrile;2,2-dinitroacetonitrile |
| PubChem CID | 174896159 |
| Molecular Formula | C9H6N4O4 |
| Molecular Weight | 234.17 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | benzonitrile;2,2-dinitroacetonitrile |
| SMILES | N#CC([N+](=O)[O-])[N+](=O)[O-].N#Cc1ccccc1 |
| InChI | InChI=1S/C7H5N.C2HN3O4/c8-6-7-4-2-1-3-5-7;3-1-2(4(6)7)5(8)9/h1-5H;2H |
| InChIKey | IBQSGJHNFBMIOX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 133.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzonitrile;2,2-dinitroacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzonitrile;2,2-dinitroacetonitrile?
The IUPAC name of benzonitrile;2,2-dinitroacetonitrile (CID 174896159) is benzonitrile;2,2-dinitroacetonitrile.
What is the SMILES notation for benzonitrile;2,2-dinitroacetonitrile?
The canonical SMILES for benzonitrile;2,2-dinitroacetonitrile is N#CC([N+](=O)[O-])[N+](=O)[O-].N#Cc1ccccc1.
What is the InChIKey of benzonitrile;2,2-dinitroacetonitrile?
The InChIKey is IBQSGJHNFBMIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.C2HN3O4/c8-6-7-4-2-1-3-5-7;3-1-2(4(6)7)5(8)9/h1-5H;2H.
What are the key properties of benzonitrile;2,2-dinitroacetonitrile?
benzonitrile;2,2-dinitroacetonitrile has a molecular weight of 234.17 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzonitrile;2,2-dinitroacetonitrile is sourced from PubChem (CID 174896159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).