About 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol
2-ethyl-6-methylphenol;5-ethyl-2-methylphenol (PubChem CID 158425788) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol.
Molecular Properties
| Compound Name | 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol |
| PubChem CID | 158425788 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol |
| SMILES | CCc1ccc(C)c(O)c1.CCc1cccc(C)c1O |
| InChI | InChI=1S/2C9H12O/c1-3-8-5-4-7(2)9(10)6-8;1-3-8-6-4-5-7(2)9(8)10/h2*4-6,10H,3H2,1-2H3 |
| InChIKey | HBALLLWKWPGMQX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol?
The IUPAC name of 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol (CID 158425788) is 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol.
What is the SMILES notation for 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol?
The canonical SMILES for 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol is CCc1ccc(C)c(O)c1.CCc1cccc(C)c1O.
What is the InChIKey of 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol?
The InChIKey is HBALLLWKWPGMQX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12O/c1-3-8-5-4-7(2)9(10)6-8;1-3-8-6-4-5-7(2)9(8)10/h2*4-6,10H,3H2,1-2H3.
What are the key properties of 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol?
2-ethyl-6-methylphenol;5-ethyl-2-methylphenol has a molecular weight of 272.39 g/mol, XLogP of 4.53, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methylphenol;5-ethyl-2-methylphenol is sourced from PubChem (CID 158425788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).