C13H7Cl2N3O2 — CID 136888723
4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol (PubChem CID 136888723) has the molecular formula C13H7Cl2N3O2 and a molecular weight of 308.12 g/mol. Its IUPAC name is 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol.
| Compound Name | 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 136888723 |
| Molecular Formula | C13H7Cl2N3O2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 4-[3-(3,5-dichlorophenyl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
| SMILES | Oc1cnccc1-c1nc(-c2cc(Cl)cc(Cl)c2)no1 |
| InChI | InChI=1S/C13H7Cl2N3O2/c14-8-3-7(4-9(15)5-8)12-17-13(20-18-12)10-1-2-16-6-11(10)19/h1-6,19H |
| InChIKey | NYEXLGHUUWNWBI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |