C11H10N4O — CID 79273565
N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine (PubChem CID 79273565) has the molecular formula C11H10N4O and a molecular weight of 214.23 g/mol. Its IUPAC name is N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 79273565 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C11H10N4O/c1-2-6-12-8-10-14-11(15-16-10)9-5-3-4-7-13-9/h1,3-5,7,12H,6,8H2 |
| InChIKey | DCKLLYWPDSSUGX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|