C12H15N3O — CID 154530032
5-(3-methylbutyl)-3-pyridin-2-yl-1,2,4-oxadiazole (PubChem CID 154530032) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-(3-methylbutyl)-3-pyridin-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(3-methylbutyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 154530032 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 5-(3-methylbutyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)CCc1nc(-c2ccccn2)no1 |
| InChI | InChI=1S/C12H15N3O/c1-9(2)6-7-11-14-12(15-16-11)10-5-3-4-8-13-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | RHMYUQXANULMLP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |