C13H17N3O — CID 122215897
N-pentyl-3-phenyl-1,2,4-oxadiazol-5-amine (PubChem CID 122215897) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is N-pentyl-3-phenyl-1,2,4-oxadiazol-5-amine.
| Compound Name | N-pentyl-3-phenyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 122215897 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-pentyl-3-phenyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCCCCNc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C13H17N3O/c1-2-3-7-10-14-13-15-12(16-17-13)11-8-5-4-6-9-11/h4-6,8-9H,2-3,7,10H2,1H3,(H,14,15,16) |
| InChIKey | BPCBPDWFWPKKEA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|