C14H15N5OS — CID 131903577
N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-phenyl-1,2,4-oxadiazol-5-amine (PubChem CID 131903577) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-phenyl-1,2,4-oxadiazol-5-amine.
| Compound Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-phenyl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 131903577 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[3-(2-amino-1,3-thiazol-4-yl)propyl]-3-phenyl-1,2,4-oxadiazol-5-amine |
| SMILES | Nc1nc(CCCNc2nc(-c3ccccc3)no2)cs1 |
| InChI | InChI=1S/C14H15N5OS/c15-13-17-11(9-21-13)7-4-8-16-14-18-12(19-20-14)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H2,15,17)(H,16,18,19) |
| InChIKey | AJDHRTRDITVWBA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|