C10H10FN3O — CID 62594100
N-ethyl-3-(4-fluorophenyl)-1,2,4-oxadiazol-5-amine (PubChem CID 62594100) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is N-ethyl-3-(4-fluorophenyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-ethyl-3-(4-fluorophenyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 62594100 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-ethyl-3-(4-fluorophenyl)-1,2,4-oxadiazol-5-amine |
| SMILES | CCNc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C10H10FN3O/c1-2-12-10-13-9(14-15-10)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3,(H,12,13,14) |
| InChIKey | KYZBFGSYYGJZSW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |