C19H25F3N4O2 — CID 42792299
6-amino-N-[2-methyl-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propyl]hexanamide (PubChem CID 42792299) has the molecular formula C19H25F3N4O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 6-amino-N-[2-methyl-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propyl]hexanamide.
| Compound Name | 6-amino-N-[2-methyl-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propyl]hexanamide |
|---|---|
| PubChem CID | 42792299 |
| Molecular Formula | C19H25F3N4O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 6-amino-N-[2-methyl-1-[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]propyl]hexanamide |
| SMILES | CC(C)C(NC(=O)CCCCCN)c1nc(-c2cccc(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C19H25F3N4O2/c1-12(2)16(24-15(27)9-4-3-5-10-23)18-25-17(26-28-18)13-7-6-8-14(11-13)19(20,21)22/h6-8,11-12,16H,3-5,9-10,23H2,1-2H3,(H,24,27) |
| InChIKey | VBXYHQBCTYTDQE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|