C18H24N4O4 — CID 98926582
3,3-dimethyl-N-[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]butanamide (PubChem CID 98926582) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3,3-dimethyl-N-[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]butanamide |
|---|---|
| PubChem CID | 98926582 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3,3-dimethyl-N-[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]butanamide |
| SMILES | CC(C)[C@H](NC(=O)CC(C)(C)C)c1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C18H24N4O4/c1-11(2)15(19-14(23)10-18(3,4)5)17-20-16(21-26-17)12-6-8-13(9-7-12)22(24)25/h6-9,11,15H,10H2,1-5H3,(H,19,23)/t15-/m0/s1 |
| InChIKey | NZAOXOBTWXMIBC-HNNXBMFYSA-N |
| XLogP | 3.89 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|