C18H26N4O5 — CID 93184035
(2S)-1-[[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 93184035) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2S)-1-[[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | (2S)-1-[[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 93184035 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | (2S)-1-[[(1S)-2-methyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propyl]amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OC[C@@H](O)CN[C@H](c1nc(-c2ccc([N+](=O)[O-])cc2)no1)C(C)C |
| InChI | InChI=1S/C18H26N4O5/c1-11(2)16(19-9-15(23)10-26-12(3)4)18-20-17(21-27-18)13-5-7-14(8-6-13)22(24)25/h5-8,11-12,15-16,19,23H,9-10H2,1-4H3/t15-,16-/m0/s1 |
| InChIKey | HGGHGJYFBFHXER-HOTGVXAUSA-N |
| XLogP | 2.72 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|