C11H12N4O3 — CID 93097128
(1S)-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine (PubChem CID 93097128) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is (1S)-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine.
| Compound Name | (1S)-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 93097128 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | (1S)-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]propan-1-amine |
| SMILES | CC[C@H](N)c1nc(-c2ccc([N+](=O)[O-])cc2)no1 |
| InChI | InChI=1S/C11H12N4O3/c1-2-9(12)11-13-10(14-18-11)7-3-5-8(6-4-7)15(16)17/h3-6,9H,2,12H2,1H3/t9-/m0/s1 |
| InChIKey | DBTLODARFCZQEI-VIFPVBQESA-N |
| XLogP | 2.05 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|