C11H5F6N3O3 — CID 19328350
5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-nitrophenyl)-1,2,4-oxadiazole (PubChem CID 19328350) has the molecular formula C11H5F6N3O3 and a molecular weight of 341.17 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-nitrophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-nitrophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 19328350 |
| Molecular Formula | C11H5F6N3O3 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-(4-nitrophenyl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2noc(C(C(F)(F)F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C11H5F6N3O3/c12-10(13,14)7(11(15,16)17)9-18-8(19-23-9)5-1-3-6(4-2-5)20(21)22/h1-4,7H |
| InChIKey | YCIRTMNVWFJXIV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 82.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|