C16H19ClN2 — CID 65485061
2-(aminomethyl)-4-chloro-N-methyl-N-(2-phenylethyl)aniline (PubChem CID 65485061) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is 2-(aminomethyl)-4-chloro-N-methyl-N-(2-phenylethyl)aniline.
| Compound Name | 2-(aminomethyl)-4-chloro-N-methyl-N-(2-phenylethyl)aniline |
|---|---|
| PubChem CID | 65485061 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-(aminomethyl)-4-chloro-N-methyl-N-(2-phenylethyl)aniline |
| SMILES | CN(CCc1ccccc1)c1ccc(Cl)cc1CN |
| InChI | InChI=1S/C16H19ClN2/c1-19(10-9-13-5-3-2-4-6-13)16-8-7-15(17)11-14(16)12-18/h2-8,11H,9-10,12,18H2,1H3 |
| InChIKey | ZFSVCHFGPKYFNT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |